C13H20BrN3O2 — CID 54878062
4-bromo-1-ethyl-N-methyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]pyrrole-2-carboxamide (PubChem CID 54878062) has the molecular formula C13H20BrN3O2 and a molecular weight of 330.23 g/mol. Its IUPAC name is 4-bromo-1-ethyl-N-methyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]pyrrole-2-carboxamide.
| Compound Name | 4-bromo-1-ethyl-N-methyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 54878062 |
| Molecular Formula | C13H20BrN3O2 |
| Molecular Weight | 330.23 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 4-bromo-1-ethyl-N-methyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]pyrrole-2-carboxamide |
| SMILES | CCn1cc(Br)cc1C(=O)N(C)CC(=O)NC(C)C |
| InChI | InChI=1S/C13H20BrN3O2/c1-5-17-7-10(14)6-11(17)13(19)16(4)8-12(18)15-9(2)3/h6-7,9H,5,8H2,1-4H3,(H,15,18) |
| InChIKey | KVRIQILJTUFHAM-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.23 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |