C14H22BrN3O3 — CID 60956181
4-bromo-1-ethyl-N-[2-(3-methoxypropylamino)-2-oxoethyl]-N-methylpyrrole-2-carboxamide (PubChem CID 60956181) has the molecular formula C14H22BrN3O3 and a molecular weight of 360.25 g/mol. Its IUPAC name is 4-bromo-1-ethyl-N-[2-(3-methoxypropylamino)-2-oxoethyl]-N-methylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-1-ethyl-N-[2-(3-methoxypropylamino)-2-oxoethyl]-N-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 60956181 |
| Molecular Formula | C14H22BrN3O3 |
| Molecular Weight | 360.25 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 4-bromo-1-ethyl-N-[2-(3-methoxypropylamino)-2-oxoethyl]-N-methylpyrrole-2-carboxamide |
| SMILES | CCn1cc(Br)cc1C(=O)N(C)CC(=O)NCCCOC |
| InChI | InChI=1S/C14H22BrN3O3/c1-4-18-9-11(15)8-12(18)14(20)17(2)10-13(19)16-6-5-7-21-3/h8-9H,4-7,10H2,1-3H3,(H,16,19) |
| InChIKey | ZXEZPKDSWIWUAF-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.25 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|