C14H17BrN2OS — CID 54877540
4-bromo-N-methyl-1-propyl-N-(thiophen-3-ylmethyl)pyrrole-2-carboxamide (PubChem CID 54877540) has the molecular formula C14H17BrN2OS and a molecular weight of 341.27 g/mol. Its IUPAC name is 4-bromo-N-methyl-1-propyl-N-(thiophen-3-ylmethyl)pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-methyl-1-propyl-N-(thiophen-3-ylmethyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 54877540 |
| Molecular Formula | C14H17BrN2OS |
| Molecular Weight | 341.27 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | 4-bromo-N-methyl-1-propyl-N-(thiophen-3-ylmethyl)pyrrole-2-carboxamide |
| SMILES | CCCn1cc(Br)cc1C(=O)N(C)Cc1ccsc1 |
| InChI | InChI=1S/C14H17BrN2OS/c1-3-5-17-9-12(15)7-13(17)14(18)16(2)8-11-4-6-19-10-11/h4,6-7,9-10H,3,5,8H2,1-2H3 |
| InChIKey | LPFASKZRHVAKBU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.27 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |