C16H20BrN3O — CID 61140816
4-amino-N-[(3-bromophenyl)methyl]-N-methyl-1-propylpyrrole-2-carboxamide (PubChem CID 61140816) has the molecular formula C16H20BrN3O and a molecular weight of 350.26 g/mol. Its IUPAC name is 4-amino-N-[(3-bromophenyl)methyl]-N-methyl-1-propylpyrrole-2-carboxamide.
| Compound Name | 4-amino-N-[(3-bromophenyl)methyl]-N-methyl-1-propylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 61140816 |
| Molecular Formula | C16H20BrN3O |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 4-amino-N-[(3-bromophenyl)methyl]-N-methyl-1-propylpyrrole-2-carboxamide |
| SMILES | CCCn1cc(N)cc1C(=O)N(C)Cc1cccc(Br)c1 |
| InChI | InChI=1S/C16H20BrN3O/c1-3-7-20-11-14(18)9-15(20)16(21)19(2)10-12-5-4-6-13(17)8-12/h4-6,8-9,11H,3,7,10,18H2,1-2H3 |
| InChIKey | XLXNETOEXJROJN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |