C15H18Br2N2OS — CID 63525471
4-bromo-N-[(5-bromothiophen-2-yl)methyl]-N-ethyl-1-propylpyrrole-2-carboxamide (PubChem CID 63525471) has the molecular formula C15H18Br2N2OS and a molecular weight of 434.20 g/mol. Its IUPAC name is 4-bromo-N-[(5-bromothiophen-2-yl)methyl]-N-ethyl-1-propylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[(5-bromothiophen-2-yl)methyl]-N-ethyl-1-propylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 63525471 |
| Molecular Formula | C15H18Br2N2OS |
| Molecular Weight | 434.20 g/mol |
| Exact Mass | 431.95 |
| IUPAC Name | 4-bromo-N-[(5-bromothiophen-2-yl)methyl]-N-ethyl-1-propylpyrrole-2-carboxamide |
| SMILES | CCCn1cc(Br)cc1C(=O)N(CC)Cc1ccc(Br)s1 |
| InChI | InChI=1S/C15H18Br2N2OS/c1-3-7-19-9-11(16)8-13(19)15(20)18(4-2)10-12-5-6-14(17)21-12/h5-6,8-9H,3-4,7,10H2,1-2H3 |
| InChIKey | QMEKVPFOMWRWFA-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.20 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |