C16H21BrN2OS — CID 79491715
4-bromo-N-methyl-1-propyl-N-(1-thiophen-2-ylpropan-2-yl)pyrrole-2-carboxamide (PubChem CID 79491715) has the molecular formula C16H21BrN2OS and a molecular weight of 369.33 g/mol. Its IUPAC name is 4-bromo-N-methyl-1-propyl-N-(1-thiophen-2-ylpropan-2-yl)pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-methyl-1-propyl-N-(1-thiophen-2-ylpropan-2-yl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 79491715 |
| Molecular Formula | C16H21BrN2OS |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 4-bromo-N-methyl-1-propyl-N-(1-thiophen-2-ylpropan-2-yl)pyrrole-2-carboxamide |
| SMILES | CCCn1cc(Br)cc1C(=O)N(C)C(C)Cc1cccs1 |
| InChI | InChI=1S/C16H21BrN2OS/c1-4-7-19-11-13(17)10-15(19)16(20)18(3)12(2)9-14-6-5-8-21-14/h5-6,8,10-12H,4,7,9H2,1-3H3 |
| InChIKey | RHDPVQCMCCZLHN-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |