C14H15BrN2O3S — CID 115283800
2-[(4-bromo-1-propylpyrrole-2-carbonyl)amino]-2-thiophen-2-ylacetic acid (PubChem CID 115283800) has the molecular formula C14H15BrN2O3S and a molecular weight of 371.26 g/mol. Its IUPAC name is 2-[(4-bromo-1-propylpyrrole-2-carbonyl)amino]-2-thiophen-2-ylacetic acid.
| Compound Name | 2-[(4-bromo-1-propylpyrrole-2-carbonyl)amino]-2-thiophen-2-ylacetic acid |
|---|---|
| PubChem CID | 115283800 |
| Molecular Formula | C14H15BrN2O3S |
| Molecular Weight | 371.26 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | 2-[(4-bromo-1-propylpyrrole-2-carbonyl)amino]-2-thiophen-2-ylacetic acid |
| SMILES | CCCn1cc(Br)cc1C(=O)NC(C(=O)O)c1cccs1 |
| InChI | InChI=1S/C14H15BrN2O3S/c1-2-5-17-8-9(15)7-10(17)13(18)16-12(14(19)20)11-4-3-6-21-11/h3-4,6-8,12H,2,5H2,1H3,(H,16,18)(H,19,20) |
| InChIKey | VXOSKJKQBWLCOI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.26 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |