C13H9Br2NO3S — CID 107971632
2-[(3,5-dibromobenzoyl)amino]-2-thiophen-2-ylacetic acid (PubChem CID 107971632) has the molecular formula C13H9Br2NO3S and a molecular weight of 419.09 g/mol. Its IUPAC name is 2-[(3,5-dibromobenzoyl)amino]-2-thiophen-2-ylacetic acid.
| Compound Name | 2-[(3,5-dibromobenzoyl)amino]-2-thiophen-2-ylacetic acid |
|---|---|
| PubChem CID | 107971632 |
| Molecular Formula | C13H9Br2NO3S |
| Molecular Weight | 419.09 g/mol |
| Exact Mass | 416.87 |
| IUPAC Name | 2-[(3,5-dibromobenzoyl)amino]-2-thiophen-2-ylacetic acid |
| SMILES | O=C(NC(C(=O)O)c1cccs1)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C13H9Br2NO3S/c14-8-4-7(5-9(15)6-8)12(17)16-11(13(18)19)10-2-1-3-20-10/h1-6,11H,(H,16,17)(H,18,19) |
| InChIKey | QKGBDAVPBHFHQU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.09 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |