C14H11N3O3S — CID 115283782
2-(1H-indazole-5-carbonylamino)-2-thiophen-2-ylacetic acid (PubChem CID 115283782) has the molecular formula C14H11N3O3S and a molecular weight of 301.33 g/mol. Its IUPAC name is 2-(1H-indazole-5-carbonylamino)-2-thiophen-2-ylacetic acid.
| Compound Name | 2-(1H-indazole-5-carbonylamino)-2-thiophen-2-ylacetic acid |
|---|---|
| PubChem CID | 115283782 |
| Molecular Formula | C14H11N3O3S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 2-(1H-indazole-5-carbonylamino)-2-thiophen-2-ylacetic acid |
| SMILES | O=C(NC(C(=O)O)c1cccs1)c1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C14H11N3O3S/c18-13(8-3-4-10-9(6-8)7-15-17-10)16-12(14(19)20)11-2-1-5-21-11/h1-7,12H,(H,15,17)(H,16,18)(H,19,20) |
| InChIKey | OUDKUXBLBGFQSP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |