C13H20ClN3O2 — CID 43639819
4-chloro-N-[(4S)-4-methoxypyrrolidin-3-yl]-1-propylpyrrole-2-carboxamide (PubChem CID 43639819) has the molecular formula C13H20ClN3O2 and a molecular weight of 285.78 g/mol. Its IUPAC name is 4-chloro-N-[(4S)-4-methoxypyrrolidin-3-yl]-1-propylpyrrole-2-carboxamide.
| Compound Name | 4-chloro-N-[(4S)-4-methoxypyrrolidin-3-yl]-1-propylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 43639819 |
| Molecular Formula | C13H20ClN3O2 |
| Molecular Weight | 285.78 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 4-chloro-N-[(4S)-4-methoxypyrrolidin-3-yl]-1-propylpyrrole-2-carboxamide |
| SMILES | CCCn1cc(Cl)cc1C(=O)NC1CNC[C@@H]1OC |
| InChI | InChI=1S/C13H20ClN3O2/c1-3-4-17-8-9(14)5-11(17)13(18)16-10-6-15-7-12(10)19-2/h5,8,10,12,15H,3-4,6-7H2,1-2H3,(H,16,18)/t10?,12-/m0/s1 |
| InChIKey | ZCLHODKQAJBPEI-KFJBMODSSA-N |
| XLogP | 1.27 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.78 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |