About 1-ethyl-3-[(3R,4R)-4-methoxypyrrolidin-3-yl]urea
1-ethyl-3-[(3R,4R)-4-methoxypyrrolidin-3-yl]urea (PubChem CID 52908262) has the molecular formula C8H17N3O2
and a molecular weight of 187.24 g/mol. Its IUPAC name is 1-ethyl-3-[(3R,4R)-4-methoxypyrrolidin-3-yl]urea.
Molecular Properties
| Compound Name | 1-ethyl-3-[(3R,4R)-4-methoxypyrrolidin-3-yl]urea |
| PubChem CID | 52908262 |
| Molecular Formula | C8H17N3O2 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.13 |
| IUPAC Name | 1-ethyl-3-[(3R,4R)-4-methoxypyrrolidin-3-yl]urea |
| SMILES | CCNC(=O)N[C@@H]1CNC[C@H]1OC |
| InChI | InChI=1S/C8H17N3O2/c1-3-10-8(12)11-6-4-9-5-7(6)13-2/h6-7,9H,3-5H2,1-2H3,(H2,10,11,12)/t6-,7-/m1/s1 |
| InChIKey | DNSNIORUJNTUIE-RNFRBKRXSA-N |
| XLogP | -0.71 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethyl-3-[(3R,4R)-4-methoxypyrrolidin-3-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-[(3R,4R)-4-methoxypyrrolidin-3-yl]urea?
The IUPAC name of 1-ethyl-3-[(3R,4R)-4-methoxypyrrolidin-3-yl]urea (CID 52908262) is 1-ethyl-3-[(3R,4R)-4-methoxypyrrolidin-3-yl]urea.
What is the SMILES notation for 1-ethyl-3-[(3R,4R)-4-methoxypyrrolidin-3-yl]urea?
The canonical SMILES for 1-ethyl-3-[(3R,4R)-4-methoxypyrrolidin-3-yl]urea is CCNC(=O)N[C@@H]1CNC[C@H]1OC.
What is the InChIKey of 1-ethyl-3-[(3R,4R)-4-methoxypyrrolidin-3-yl]urea?
The InChIKey is DNSNIORUJNTUIE-RNFRBKRXSA-N. The full InChI is InChI=1S/C8H17N3O2/c1-3-10-8(12)11-6-4-9-5-7(6)13-2/h6-7,9H,3-5H2,1-2H3,(H2,10,11,12)/t6-,7-/m1/s1.
What are the key properties of 1-ethyl-3-[(3R,4R)-4-methoxypyrrolidin-3-yl]urea?
1-ethyl-3-[(3R,4R)-4-methoxypyrrolidin-3-yl]urea has a molecular weight of 187.24 g/mol, XLogP of -0.71, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-[(3R,4R)-4-methoxypyrrolidin-3-yl]urea is sourced from PubChem (CID 52908262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).