C7H11F3N2O2 — CID 130773345
2,2,2-trifluoro-N-[(3R,4S)-4-methoxypyrrolidin-3-yl]acetamide (PubChem CID 130773345) has the molecular formula C7H11F3N2O2 and a molecular weight of 212.17 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(3R,4S)-4-methoxypyrrolidin-3-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(3R,4S)-4-methoxypyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 130773345 |
| Molecular Formula | C7H11F3N2O2 |
| Molecular Weight | 212.17 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 2,2,2-trifluoro-N-[(3R,4S)-4-methoxypyrrolidin-3-yl]acetamide |
| SMILES | CO[C@H]1CNC[C@H]1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C7H11F3N2O2/c1-14-5-3-11-2-4(5)12-6(13)7(8,9)10/h4-5,11H,2-3H2,1H3,(H,12,13)/t4-,5+/m1/s1 |
| InChIKey | HLHIPHTXSVFRPC-UHNVWZDZSA-N |
| XLogP | -0.35 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.17 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |