C11H15ClN2O3 — CID 61262853
2-[(4-chloro-1-ethylpyrrole-2-carbonyl)amino]-2-methylpropanoic acid (PubChem CID 61262853) has the molecular formula C11H15ClN2O3 and a molecular weight of 258.70 g/mol. Its IUPAC name is 2-[(4-chloro-1-ethylpyrrole-2-carbonyl)amino]-2-methylpropanoic acid.
| Compound Name | 2-[(4-chloro-1-ethylpyrrole-2-carbonyl)amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 61262853 |
| Molecular Formula | C11H15ClN2O3 |
| Molecular Weight | 258.70 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 2-[(4-chloro-1-ethylpyrrole-2-carbonyl)amino]-2-methylpropanoic acid |
| SMILES | CCn1cc(Cl)cc1C(=O)NC(C)(C)C(=O)O |
| InChI | InChI=1S/C11H15ClN2O3/c1-4-14-6-7(12)5-8(14)9(15)13-11(2,3)10(16)17/h5-6H,4H2,1-3H3,(H,13,15)(H,16,17) |
| InChIKey | LWQIHDCBRAEDRS-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.70 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |