C13H19ClN2O3 — CID 81066132
3-[[(4-chloro-1-ethylpyrrole-2-carbonyl)amino]methyl]pentanoic acid (PubChem CID 81066132) has the molecular formula C13H19ClN2O3 and a molecular weight of 286.76 g/mol. Its IUPAC name is 3-[[(4-chloro-1-ethylpyrrole-2-carbonyl)amino]methyl]pentanoic acid.
| Compound Name | 3-[[(4-chloro-1-ethylpyrrole-2-carbonyl)amino]methyl]pentanoic acid |
|---|---|
| PubChem CID | 81066132 |
| Molecular Formula | C13H19ClN2O3 |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 3-[[(4-chloro-1-ethylpyrrole-2-carbonyl)amino]methyl]pentanoic acid |
| SMILES | CCC(CNC(=O)c1cc(Cl)cn1CC)CC(=O)O |
| InChI | InChI=1S/C13H19ClN2O3/c1-3-9(5-12(17)18)7-15-13(19)11-6-10(14)8-16(11)4-2/h6,8-9H,3-5,7H2,1-2H3,(H,15,19)(H,17,18) |
| InChIKey | HTSNPLWYGXASQA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |