C13H19ClN2O3 — CID 78975609
(2R)-2-[(4-chloro-1-ethylpyrrole-2-carbonyl)amino]-4-methylpentanoic acid (PubChem CID 78975609) has the molecular formula C13H19ClN2O3 and a molecular weight of 286.76 g/mol. Its IUPAC name is (2R)-2-[(4-chloro-1-ethylpyrrole-2-carbonyl)amino]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[(4-chloro-1-ethylpyrrole-2-carbonyl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 78975609 |
| Molecular Formula | C13H19ClN2O3 |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | (2R)-2-[(4-chloro-1-ethylpyrrole-2-carbonyl)amino]-4-methylpentanoic acid |
| SMILES | CCn1cc(Cl)cc1C(=O)N[C@H](CC(C)C)C(=O)O |
| InChI | InChI=1S/C13H19ClN2O3/c1-4-16-7-9(14)6-11(16)12(17)15-10(13(18)19)5-8(2)3/h6-8,10H,4-5H2,1-3H3,(H,15,17)(H,18,19)/t10-/m1/s1 |
| InChIKey | LSBHLNPCZOBGPJ-SNVBAGLBSA-N |
| XLogP | 2.39 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |