C11H17BrN2O2 — CID 64555951
4-bromo-N-(1-hydroxy-2-methylbutan-2-yl)-1-methylpyrrole-2-carboxamide (PubChem CID 64555951) has the molecular formula C11H17BrN2O2 and a molecular weight of 289.17 g/mol. Its IUPAC name is 4-bromo-N-(1-hydroxy-2-methylbutan-2-yl)-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-(1-hydroxy-2-methylbutan-2-yl)-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 64555951 |
| Molecular Formula | C11H17BrN2O2 |
| Molecular Weight | 289.17 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 4-bromo-N-(1-hydroxy-2-methylbutan-2-yl)-1-methylpyrrole-2-carboxamide |
| SMILES | CCC(C)(CO)NC(=O)c1cc(Br)cn1C |
| InChI | InChI=1S/C11H17BrN2O2/c1-4-11(2,7-15)13-10(16)9-5-8(12)6-14(9)3/h5-6,15H,4,7H2,1-3H3,(H,13,16) |
| InChIKey | WGHJOBLBQNJLLP-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.17 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |