C12H21BrClN3O — CID 119570119
N-[3-(aminomethyl)pentan-3-yl]-4-bromo-1-methylpyrrole-2-carboxamide;hydrochloride (PubChem CID 119570119) has the molecular formula C12H21BrClN3O and a molecular weight of 338.68 g/mol. Its IUPAC name is N-[3-(aminomethyl)pentan-3-yl]-4-bromo-1-methylpyrrole-2-carboxamide;hydrochloride.
| Compound Name | N-[3-(aminomethyl)pentan-3-yl]-4-bromo-1-methylpyrrole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119570119 |
| Molecular Formula | C12H21BrClN3O |
| Molecular Weight | 338.68 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | N-[3-(aminomethyl)pentan-3-yl]-4-bromo-1-methylpyrrole-2-carboxamide;hydrochloride |
| SMILES | CCC(CC)(CN)NC(=O)c1cc(Br)cn1C.Cl |
| InChI | InChI=1S/C12H20BrN3O.ClH/c1-4-12(5-2,8-14)15-11(17)10-6-9(13)7-16(10)3;/h6-7H,4-5,8,14H2,1-3H3,(H,15,17);1H |
| InChIKey | HPPIOUFAWRPZOF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.68 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |