C12H23ClN4O3S — CID 119981288
4-[3-(aminomethyl)pentan-3-ylsulfamoyl]-1-methylpyrrole-2-carboxamide;hydrochloride (PubChem CID 119981288) has the molecular formula C12H23ClN4O3S and a molecular weight of 338.86 g/mol. Its IUPAC name is 4-[3-(aminomethyl)pentan-3-ylsulfamoyl]-1-methylpyrrole-2-carboxamide;hydrochloride.
| Compound Name | 4-[3-(aminomethyl)pentan-3-ylsulfamoyl]-1-methylpyrrole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119981288 |
| Molecular Formula | C12H23ClN4O3S |
| Molecular Weight | 338.86 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 4-[3-(aminomethyl)pentan-3-ylsulfamoyl]-1-methylpyrrole-2-carboxamide;hydrochloride |
| SMILES | CCC(CC)(CN)NS(=O)(=O)c1cc(C(N)=O)n(C)c1.Cl |
| InChI | InChI=1S/C12H22N4O3S.ClH/c1-4-12(5-2,8-13)15-20(18,19)9-6-10(11(14)17)16(3)7-9;/h6-7,15H,4-5,8,13H2,1-3H3,(H2,14,17);1H |
| InChIKey | BFTXTCACRWXQPH-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 120.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.86 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |