C9H15N3O4S — CID 83030008
4-[[(2R)-2-hydroxypropyl]sulfamoyl]-1-methylpyrrole-2-carboxamide (PubChem CID 83030008) has the molecular formula C9H15N3O4S and a molecular weight of 261.30 g/mol. Its IUPAC name is 4-[[(2R)-2-hydroxypropyl]sulfamoyl]-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-[[(2R)-2-hydroxypropyl]sulfamoyl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 83030008 |
| Molecular Formula | C9H15N3O4S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 4-[[(2R)-2-hydroxypropyl]sulfamoyl]-1-methylpyrrole-2-carboxamide |
| SMILES | C[C@@H](O)CNS(=O)(=O)c1cc(C(N)=O)n(C)c1 |
| InChI | InChI=1S/C9H15N3O4S/c1-6(13)4-11-17(15,16)7-3-8(9(10)14)12(2)5-7/h3,5-6,11,13H,4H2,1-2H3,(H2,10,14)/t6-/m1/s1 |
| InChIKey | GPFPPRDQIVITQD-ZCFIWIBFSA-N |
| XLogP | -1.22 |
| TPSA | 114.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |