C12H21N3O4S — CID 103834466
4-[(2-hydroxy-4-methylpentyl)sulfamoyl]-1-methylpyrrole-2-carboxamide (PubChem CID 103834466) has the molecular formula C12H21N3O4S and a molecular weight of 303.38 g/mol. Its IUPAC name is 4-[(2-hydroxy-4-methylpentyl)sulfamoyl]-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-[(2-hydroxy-4-methylpentyl)sulfamoyl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 103834466 |
| Molecular Formula | C12H21N3O4S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 4-[(2-hydroxy-4-methylpentyl)sulfamoyl]-1-methylpyrrole-2-carboxamide |
| SMILES | CC(C)CC(O)CNS(=O)(=O)c1cc(C(N)=O)n(C)c1 |
| InChI | InChI=1S/C12H21N3O4S/c1-8(2)4-9(16)6-14-20(18,19)10-5-11(12(13)17)15(3)7-10/h5,7-9,14,16H,4,6H2,1-3H3,(H2,13,17) |
| InChIKey | OXZCYOWTAPQOEC-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 114.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |