C9H17ClN4O3S — CID 119973057
1-methyl-4-[2-(methylamino)ethylsulfamoyl]pyrrole-2-carboxamide;hydrochloride (PubChem CID 119973057) has the molecular formula C9H17ClN4O3S and a molecular weight of 296.78 g/mol. Its IUPAC name is 1-methyl-4-[2-(methylamino)ethylsulfamoyl]pyrrole-2-carboxamide;hydrochloride.
| Compound Name | 1-methyl-4-[2-(methylamino)ethylsulfamoyl]pyrrole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119973057 |
| Molecular Formula | C9H17ClN4O3S |
| Molecular Weight | 296.78 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 1-methyl-4-[2-(methylamino)ethylsulfamoyl]pyrrole-2-carboxamide;hydrochloride |
| SMILES | CNCCNS(=O)(=O)c1cc(C(N)=O)n(C)c1.Cl |
| InChI | InChI=1S/C9H16N4O3S.ClH/c1-11-3-4-12-17(15,16)7-5-8(9(10)14)13(2)6-7;/h5-6,11-12H,3-4H2,1-2H3,(H2,10,14);1H |
| InChIKey | FHHFNKYZKPEUOX-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 106.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.78 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|