C11H20N4O3S — CID 62664942
4-[2-(ethylamino)ethylsulfamoyl]-N,1-dimethylpyrrole-2-carboxamide (PubChem CID 62664942) has the molecular formula C11H20N4O3S and a molecular weight of 288.37 g/mol. Its IUPAC name is 4-[2-(ethylamino)ethylsulfamoyl]-N,1-dimethylpyrrole-2-carboxamide.
| Compound Name | 4-[2-(ethylamino)ethylsulfamoyl]-N,1-dimethylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 62664942 |
| Molecular Formula | C11H20N4O3S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 4-[2-(ethylamino)ethylsulfamoyl]-N,1-dimethylpyrrole-2-carboxamide |
| SMILES | CCNCCNS(=O)(=O)c1cc(C(=O)NC)n(C)c1 |
| InChI | InChI=1S/C11H20N4O3S/c1-4-13-5-6-14-19(17,18)9-7-10(11(16)12-2)15(3)8-9/h7-8,13-14H,4-6H2,1-3H3,(H,12,16) |
| InChIKey | ASBZKGYVVMTFKM-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 92.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|