C10H19ClN4O3S — CID 119988182
4-[(2-amino-2-methylpropyl)sulfamoyl]-1-methylpyrrole-2-carboxamide;hydrochloride (PubChem CID 119988182) has the molecular formula C10H19ClN4O3S and a molecular weight of 310.81 g/mol. Its IUPAC name is 4-[(2-amino-2-methylpropyl)sulfamoyl]-1-methylpyrrole-2-carboxamide;hydrochloride.
| Compound Name | 4-[(2-amino-2-methylpropyl)sulfamoyl]-1-methylpyrrole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119988182 |
| Molecular Formula | C10H19ClN4O3S |
| Molecular Weight | 310.81 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 4-[(2-amino-2-methylpropyl)sulfamoyl]-1-methylpyrrole-2-carboxamide;hydrochloride |
| SMILES | Cl.Cn1cc(S(=O)(=O)NCC(C)(C)N)cc1C(N)=O |
| InChI | InChI=1S/C10H18N4O3S.ClH/c1-10(2,12)6-13-18(16,17)7-4-8(9(11)15)14(3)5-7;/h4-5,13H,6,12H2,1-3H3,(H2,11,15);1H |
| InChIKey | XRKQMQGZYUWYOY-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 120.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.81 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |