C11H18N4O3S — CID 115301253
4-[(2-amino-2-cyclopropylethyl)sulfamoyl]-1-methylpyrrole-2-carboxamide (PubChem CID 115301253) has the molecular formula C11H18N4O3S and a molecular weight of 286.36 g/mol. Its IUPAC name is 4-[(2-amino-2-cyclopropylethyl)sulfamoyl]-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-[(2-amino-2-cyclopropylethyl)sulfamoyl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 115301253 |
| Molecular Formula | C11H18N4O3S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 4-[(2-amino-2-cyclopropylethyl)sulfamoyl]-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cc(S(=O)(=O)NCC(N)C2CC2)cc1C(N)=O |
| InChI | InChI=1S/C11H18N4O3S/c1-15-6-8(4-10(15)11(13)16)19(17,18)14-5-9(12)7-2-3-7/h4,6-7,9,14H,2-3,5,12H2,1H3,(H2,13,16) |
| InChIKey | UCEKYAACERDEBW-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 120.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |