C13H16N4O5S2 — CID 55573254
4-[[4-(methanesulfonamido)phenyl]sulfamoyl]-1-methylpyrrole-2-carboxamide (PubChem CID 55573254) has the molecular formula C13H16N4O5S2 and a molecular weight of 372.43 g/mol. Its IUPAC name is 4-[[4-(methanesulfonamido)phenyl]sulfamoyl]-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-[[4-(methanesulfonamido)phenyl]sulfamoyl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 55573254 |
| Molecular Formula | C13H16N4O5S2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 4-[[4-(methanesulfonamido)phenyl]sulfamoyl]-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cc(S(=O)(=O)Nc2ccc(NS(C)(=O)=O)cc2)cc1C(N)=O |
| InChI | InChI=1S/C13H16N4O5S2/c1-17-8-11(7-12(17)13(14)18)24(21,22)16-10-5-3-9(4-6-10)15-23(2,19)20/h3-8,15-16H,1-2H3,(H2,14,18) |
| InChIKey | CRIYBQLHSZDXFN-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 140.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_D(2)', 'substructure': 'N/A'} |
|---|