C8H10N6O3S — CID 62944648
1-methyl-4-(1H-1,2,4-triazol-5-ylsulfamoyl)pyrrole-2-carboxamide (PubChem CID 62944648) has the molecular formula C8H10N6O3S and a molecular weight of 270.27 g/mol. Its IUPAC name is 1-methyl-4-(1H-1,2,4-triazol-5-ylsulfamoyl)pyrrole-2-carboxamide.
| Compound Name | 1-methyl-4-(1H-1,2,4-triazol-5-ylsulfamoyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 62944648 |
| Molecular Formula | C8H10N6O3S |
| Molecular Weight | 270.27 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 1-methyl-4-(1H-1,2,4-triazol-5-ylsulfamoyl)pyrrole-2-carboxamide |
| SMILES | Cn1cc(S(=O)(=O)Nc2ncn[nH]2)cc1C(N)=O |
| InChI | InChI=1S/C8H10N6O3S/c1-14-3-5(2-6(14)7(9)15)18(16,17)13-8-10-4-11-12-8/h2-4H,1H3,(H2,9,15)(H2,10,11,12,13) |
| InChIKey | XOIANFQDDZXVSF-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 135.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.27 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |