C10H10BrN5O3S — CID 115733506
4-[(5-bromopyrazin-2-yl)sulfamoyl]-1-methylpyrrole-2-carboxamide (PubChem CID 115733506) has the molecular formula C10H10BrN5O3S and a molecular weight of 360.19 g/mol. Its IUPAC name is 4-[(5-bromopyrazin-2-yl)sulfamoyl]-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-[(5-bromopyrazin-2-yl)sulfamoyl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 115733506 |
| Molecular Formula | C10H10BrN5O3S |
| Molecular Weight | 360.19 g/mol |
| Exact Mass | 358.97 |
| IUPAC Name | 4-[(5-bromopyrazin-2-yl)sulfamoyl]-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cc(S(=O)(=O)Nc2cnc(Br)cn2)cc1C(N)=O |
| InChI | InChI=1S/C10H10BrN5O3S/c1-16-5-6(2-7(16)10(12)17)20(18,19)15-9-4-13-8(11)3-14-9/h2-5H,1H3,(H2,12,17)(H,14,15) |
| InChIKey | LSGZQOXVRUIVSY-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.19 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |