C13H12F3N3O4S — CID 35507297
1-methyl-4-[[4-(trifluoromethoxy)phenyl]sulfamoyl]pyrrole-2-carboxamide (PubChem CID 35507297) has the molecular formula C13H12F3N3O4S and a molecular weight of 363.32 g/mol. Its IUPAC name is 1-methyl-4-[[4-(trifluoromethoxy)phenyl]sulfamoyl]pyrrole-2-carboxamide.
| Compound Name | 1-methyl-4-[[4-(trifluoromethoxy)phenyl]sulfamoyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 35507297 |
| Molecular Formula | C13H12F3N3O4S |
| Molecular Weight | 363.32 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | 1-methyl-4-[[4-(trifluoromethoxy)phenyl]sulfamoyl]pyrrole-2-carboxamide |
| SMILES | Cn1cc(S(=O)(=O)Nc2ccc(OC(F)(F)F)cc2)cc1C(N)=O |
| InChI | InChI=1S/C13H12F3N3O4S/c1-19-7-10(6-11(19)12(17)20)24(21,22)18-8-2-4-9(5-3-8)23-13(14,15)16/h2-7,18H,1H3,(H2,17,20) |
| InChIKey | SUGMEYQHAFGHSN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |