C14H14N4O3S — CID 37263793
4-[[4-(cyanomethyl)phenyl]sulfamoyl]-1-methylpyrrole-2-carboxamide (PubChem CID 37263793) has the molecular formula C14H14N4O3S and a molecular weight of 318.36 g/mol. Its IUPAC name is 4-[[4-(cyanomethyl)phenyl]sulfamoyl]-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-[[4-(cyanomethyl)phenyl]sulfamoyl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 37263793 |
| Molecular Formula | C14H14N4O3S |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 4-[[4-(cyanomethyl)phenyl]sulfamoyl]-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cc(S(=O)(=O)Nc2ccc(CC#N)cc2)cc1C(N)=O |
| InChI | InChI=1S/C14H14N4O3S/c1-18-9-12(8-13(18)14(16)19)22(20,21)17-11-4-2-10(3-5-11)6-7-15/h2-5,8-9,17H,6H2,1H3,(H2,16,19) |
| InChIKey | RBYZWDQMJWUHSC-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |