C10H10ClN5O3S — CID 116798901
4-[(2-chloropyrimidin-4-yl)sulfamoyl]-1-methylpyrrole-2-carboxamide (PubChem CID 116798901) has the molecular formula C10H10ClN5O3S and a molecular weight of 315.74 g/mol. Its IUPAC name is 4-[(2-chloropyrimidin-4-yl)sulfamoyl]-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-[(2-chloropyrimidin-4-yl)sulfamoyl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 116798901 |
| Molecular Formula | C10H10ClN5O3S |
| Molecular Weight | 315.74 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | 4-[(2-chloropyrimidin-4-yl)sulfamoyl]-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cc(S(=O)(=O)Nc2ccnc(Cl)n2)cc1C(N)=O |
| InChI | InChI=1S/C10H10ClN5O3S/c1-16-5-6(4-7(16)9(12)17)20(18,19)15-8-2-3-13-10(11)14-8/h2-5H,1H3,(H2,12,17)(H,13,14,15) |
| InChIKey | IBGXXKXWXOCGIX-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.74 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |