C12H11ClN4O3S — CID 116798900
5-[(2-chloropyrimidin-4-yl)sulfamoyl]-2-methylbenzamide (PubChem CID 116798900) has the molecular formula C12H11ClN4O3S and a molecular weight of 326.77 g/mol. Its IUPAC name is 5-[(2-chloropyrimidin-4-yl)sulfamoyl]-2-methylbenzamide.
| Compound Name | 5-[(2-chloropyrimidin-4-yl)sulfamoyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 116798900 |
| Molecular Formula | C12H11ClN4O3S |
| Molecular Weight | 326.77 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 5-[(2-chloropyrimidin-4-yl)sulfamoyl]-2-methylbenzamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccnc(Cl)n2)cc1C(N)=O |
| InChI | InChI=1S/C12H11ClN4O3S/c1-7-2-3-8(6-9(7)11(14)18)21(19,20)17-10-4-5-15-12(13)16-10/h2-6H,1H3,(H2,14,18)(H,15,16,17) |
| InChIKey | GKQQHCRCBNYIOJ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.77 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |