About 4-chloro-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-1-propan-2-ylpyrrole-2-carboxamide
4-chloro-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-1-propan-2-ylpyrrole-2-carboxamide (PubChem CID 107845959) has the molecular formula C12H19ClN2O4
and a molecular weight of 290.75 g/mol. Its IUPAC name is 4-chloro-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-1-propan-2-ylpyrrole-2-carboxamide.
Molecular Properties
| Compound Name | 4-chloro-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-1-propan-2-ylpyrrole-2-carboxamide |
| PubChem CID | 107845959 |
| Molecular Formula | C12H19ClN2O4 |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 4-chloro-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-1-propan-2-ylpyrrole-2-carboxamide |
| SMILES | CC(C)n1cc(Cl)cc1C(=O)NC(CO)(CO)CO |
| InChI | InChI=1S/C12H19ClN2O4/c1-8(2)15-4-9(13)3-10(15)11(19)14-12(5-16,6-17)7-18/h3-4,8,16-18H,5-7H2,1-2H3,(H,14,19) |
| InChIKey | QPERJXROFXUIAT-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 94.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-chloro-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-1-propan-2-ylpyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-1-propan-2-ylpyrrole-2-carboxamide?
The IUPAC name of 4-chloro-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-1-propan-2-ylpyrrole-2-carboxamide (CID 107845959) is 4-chloro-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-1-propan-2-ylpyrrole-2-carboxamide.
What is the SMILES notation for 4-chloro-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-1-propan-2-ylpyrrole-2-carboxamide?
The canonical SMILES for 4-chloro-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-1-propan-2-ylpyrrole-2-carboxamide is CC(C)n1cc(Cl)cc1C(=O)NC(CO)(CO)CO.
What is the InChIKey of 4-chloro-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-1-propan-2-ylpyrrole-2-carboxamide?
The InChIKey is QPERJXROFXUIAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19ClN2O4/c1-8(2)15-4-9(13)3-10(15)11(19)14-12(5-16,6-17)7-18/h3-4,8,16-18H,5-7H2,1-2H3,(H,14,19).
What are the key properties of 4-chloro-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-1-propan-2-ylpyrrole-2-carboxamide?
4-chloro-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-1-propan-2-ylpyrrole-2-carboxamide has a molecular weight of 290.75 g/mol, XLogP of 0.17, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-1-propan-2-ylpyrrole-2-carboxamide is sourced from PubChem (CID 107845959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).