C12H19ClN2O3 — CID 106182879
4-chloro-N-(1-hydroxy-3-methoxypropan-2-yl)-1-propan-2-ylpyrrole-2-carboxamide (PubChem CID 106182879) has the molecular formula C12H19ClN2O3 and a molecular weight of 274.75 g/mol. Its IUPAC name is 4-chloro-N-(1-hydroxy-3-methoxypropan-2-yl)-1-propan-2-ylpyrrole-2-carboxamide.
| Compound Name | 4-chloro-N-(1-hydroxy-3-methoxypropan-2-yl)-1-propan-2-ylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 106182879 |
| Molecular Formula | C12H19ClN2O3 |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 4-chloro-N-(1-hydroxy-3-methoxypropan-2-yl)-1-propan-2-ylpyrrole-2-carboxamide |
| SMILES | COCC(CO)NC(=O)c1cc(Cl)cn1C(C)C |
| InChI | InChI=1S/C12H19ClN2O3/c1-8(2)15-5-9(13)4-11(15)12(17)14-10(6-16)7-18-3/h4-5,8,10,16H,6-7H2,1-3H3,(H,14,17) |
| InChIKey | APRGFUJIUVQUSH-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |