C14H24ClN3O — CID 115305800
N-(2-amino-2-ethylbutyl)-4-chloro-1-propan-2-ylpyrrole-2-carboxamide (PubChem CID 115305800) has the molecular formula C14H24ClN3O and a molecular weight of 285.82 g/mol. Its IUPAC name is N-(2-amino-2-ethylbutyl)-4-chloro-1-propan-2-ylpyrrole-2-carboxamide.
| Compound Name | N-(2-amino-2-ethylbutyl)-4-chloro-1-propan-2-ylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 115305800 |
| Molecular Formula | C14H24ClN3O |
| Molecular Weight | 285.82 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | N-(2-amino-2-ethylbutyl)-4-chloro-1-propan-2-ylpyrrole-2-carboxamide |
| SMILES | CCC(N)(CC)CNC(=O)c1cc(Cl)cn1C(C)C |
| InChI | InChI=1S/C14H24ClN3O/c1-5-14(16,6-2)9-17-13(19)12-7-11(15)8-18(12)10(3)4/h7-8,10H,5-6,9,16H2,1-4H3,(H,17,19) |
| InChIKey | NNMCWJHBWHAGEI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.82 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |