C13H19ClN2O3 — CID 55008014
ethyl 2-[(4-chloro-1-propan-2-ylpyrrole-2-carbonyl)-methylamino]acetate (PubChem CID 55008014) has the molecular formula C13H19ClN2O3 and a molecular weight of 286.76 g/mol. Its IUPAC name is ethyl 2-[(4-chloro-1-propan-2-ylpyrrole-2-carbonyl)-methylamino]acetate.
| Compound Name | ethyl 2-[(4-chloro-1-propan-2-ylpyrrole-2-carbonyl)-methylamino]acetate |
|---|---|
| PubChem CID | 55008014 |
| Molecular Formula | C13H19ClN2O3 |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | ethyl 2-[(4-chloro-1-propan-2-ylpyrrole-2-carbonyl)-methylamino]acetate |
| SMILES | CCOC(=O)CN(C)C(=O)c1cc(Cl)cn1C(C)C |
| InChI | InChI=1S/C13H19ClN2O3/c1-5-19-12(17)8-15(4)13(18)11-6-10(14)7-16(11)9(2)3/h6-7,9H,5,8H2,1-4H3 |
| InChIKey | CBDAWDLFQKGNOO-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |