C11H10Cl2N2OS — CID 32831369
4-chloro-N-[(5-chlorothiophen-2-yl)methyl]-1-methylpyrrole-2-carboxamide (PubChem CID 32831369) has the molecular formula C11H10Cl2N2OS and a molecular weight of 289.19 g/mol. Its IUPAC name is 4-chloro-N-[(5-chlorothiophen-2-yl)methyl]-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-chloro-N-[(5-chlorothiophen-2-yl)methyl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 32831369 |
| Molecular Formula | C11H10Cl2N2OS |
| Molecular Weight | 289.19 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | 4-chloro-N-[(5-chlorothiophen-2-yl)methyl]-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cc(Cl)cc1C(=O)NCc1ccc(Cl)s1 |
| InChI | InChI=1S/C11H10Cl2N2OS/c1-15-6-7(12)4-9(15)11(16)14-5-8-2-3-10(13)17-8/h2-4,6H,5H2,1H3,(H,14,16) |
| InChIKey | XHGRKJVQWQMRRU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.19 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |