C16H23ClN4O — CID 119643000
N-(2-amino-2-ethylbutyl)-3-phenyl-1H-pyrazole-5-carboxamide;hydrochloride (PubChem CID 119643000) has the molecular formula C16H23ClN4O and a molecular weight of 322.84 g/mol. Its IUPAC name is N-(2-amino-2-ethylbutyl)-3-phenyl-1H-pyrazole-5-carboxamide;hydrochloride.
| Compound Name | N-(2-amino-2-ethylbutyl)-3-phenyl-1H-pyrazole-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119643000 |
| Molecular Formula | C16H23ClN4O |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | N-(2-amino-2-ethylbutyl)-3-phenyl-1H-pyrazole-5-carboxamide;hydrochloride |
| SMILES | CCC(N)(CC)CNC(=O)c1cc(-c2ccccc2)n[nH]1.Cl |
| InChI | InChI=1S/C16H22N4O.ClH/c1-3-16(17,4-2)11-18-15(21)14-10-13(19-20-14)12-8-6-5-7-9-12;/h5-10H,3-4,11,17H2,1-2H3,(H,18,21)(H,19,20);1H |
| InChIKey | PLFFJKXEFDQMTO-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |