C14H12Cl2N2O3 — CID 63794751
3-[2-[(4,5-dichloro-1H-pyrrole-2-carbonyl)amino]ethyl]benzoic acid (PubChem CID 63794751) has the molecular formula C14H12Cl2N2O3 and a molecular weight of 327.17 g/mol. Its IUPAC name is 3-[2-[(4,5-dichloro-1H-pyrrole-2-carbonyl)amino]ethyl]benzoic acid.
| Compound Name | 3-[2-[(4,5-dichloro-1H-pyrrole-2-carbonyl)amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 63794751 |
| Molecular Formula | C14H12Cl2N2O3 |
| Molecular Weight | 327.17 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 3-[2-[(4,5-dichloro-1H-pyrrole-2-carbonyl)amino]ethyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CCNC(=O)c2cc(Cl)c(Cl)[nH]2)c1 |
| InChI | InChI=1S/C14H12Cl2N2O3/c15-10-7-11(18-12(10)16)13(19)17-5-4-8-2-1-3-9(6-8)14(20)21/h1-3,6-7,18H,4-5H2,(H,17,19)(H,20,21) |
| InChIKey | RKLMGIFANQDIPZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.17 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |