C18H15ClN4O3 — CID 167860031
3-[2-[[1-(2-chlorophenyl)triazole-4-carbonyl]amino]ethyl]benzoic acid (PubChem CID 167860031) has the molecular formula C18H15ClN4O3 and a molecular weight of 370.80 g/mol. Its IUPAC name is 3-[2-[[1-(2-chlorophenyl)triazole-4-carbonyl]amino]ethyl]benzoic acid.
| Compound Name | 3-[2-[[1-(2-chlorophenyl)triazole-4-carbonyl]amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 167860031 |
| Molecular Formula | C18H15ClN4O3 |
| Molecular Weight | 370.80 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 3-[2-[[1-(2-chlorophenyl)triazole-4-carbonyl]amino]ethyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CCNC(=O)c2cn(-c3ccccc3Cl)nn2)c1 |
| InChI | InChI=1S/C18H15ClN4O3/c19-14-6-1-2-7-16(14)23-11-15(21-22-23)17(24)20-9-8-12-4-3-5-13(10-12)18(25)26/h1-7,10-11H,8-9H2,(H,20,24)(H,25,26) |
| InChIKey | QGXMMPAHAOXOKE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.80 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |