C15H11ClFN5O — CID 141406259
1-(2-chlorophenyl)-N'-(3-fluorophenyl)triazole-4-carbohydrazide (PubChem CID 141406259) has the molecular formula C15H11ClFN5O and a molecular weight of 331.74 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N'-(3-fluorophenyl)triazole-4-carbohydrazide.
| Compound Name | 1-(2-chlorophenyl)-N'-(3-fluorophenyl)triazole-4-carbohydrazide |
|---|---|
| PubChem CID | 141406259 |
| Molecular Formula | C15H11ClFN5O |
| Molecular Weight | 331.74 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 1-(2-chlorophenyl)-N'-(3-fluorophenyl)triazole-4-carbohydrazide |
| SMILES | O=C(NNc1cccc(F)c1)c1cn(-c2ccccc2Cl)nn1 |
| InChI | InChI=1S/C15H11ClFN5O/c16-12-6-1-2-7-14(12)22-9-13(19-21-22)15(23)20-18-11-5-3-4-10(17)8-11/h1-9,18H,(H,20,23) |
| InChIKey | BWWPORMTAOXUHR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.74 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|