C14H12ClFN4O3S — CID 120531493
3-[[1-(3-chloro-2-fluorophenyl)triazole-4-carbonyl]amino]thiolane-3-carboxylic acid (PubChem CID 120531493) has the molecular formula C14H12ClFN4O3S and a molecular weight of 370.79 g/mol. Its IUPAC name is 3-[[1-(3-chloro-2-fluorophenyl)triazole-4-carbonyl]amino]thiolane-3-carboxylic acid.
| Compound Name | 3-[[1-(3-chloro-2-fluorophenyl)triazole-4-carbonyl]amino]thiolane-3-carboxylic acid |
|---|---|
| PubChem CID | 120531493 |
| Molecular Formula | C14H12ClFN4O3S |
| Molecular Weight | 370.79 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | 3-[[1-(3-chloro-2-fluorophenyl)triazole-4-carbonyl]amino]thiolane-3-carboxylic acid |
| SMILES | O=C(NC1(C(=O)O)CCSC1)c1cn(-c2cccc(Cl)c2F)nn1 |
| InChI | InChI=1S/C14H12ClFN4O3S/c15-8-2-1-3-10(11(8)16)20-6-9(18-19-20)12(21)17-14(13(22)23)4-5-24-7-14/h1-3,6H,4-5,7H2,(H,17,21)(H,22,23) |
| InChIKey | QRYFKICVVIOUIU-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.79 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |