C15H16ClFN4O3 — CID 120519463
4-[[1-(3-chloro-2-fluorophenyl)triazole-4-carbonyl]amino]-4-methylpentanoic acid (PubChem CID 120519463) has the molecular formula C15H16ClFN4O3 and a molecular weight of 354.77 g/mol. Its IUPAC name is 4-[[1-(3-chloro-2-fluorophenyl)triazole-4-carbonyl]amino]-4-methylpentanoic acid.
| Compound Name | 4-[[1-(3-chloro-2-fluorophenyl)triazole-4-carbonyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 120519463 |
| Molecular Formula | C15H16ClFN4O3 |
| Molecular Weight | 354.77 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 4-[[1-(3-chloro-2-fluorophenyl)triazole-4-carbonyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)(CCC(=O)O)NC(=O)c1cn(-c2cccc(Cl)c2F)nn1 |
| InChI | InChI=1S/C15H16ClFN4O3/c1-15(2,7-6-12(22)23)18-14(24)10-8-21(20-19-10)11-5-3-4-9(16)13(11)17/h3-5,8H,6-7H2,1-2H3,(H,18,24)(H,22,23) |
| InChIKey | IFMBIULPSVZTOE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.77 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |