C17H18ClN3O3S — CID 119357320
4-[[6-(2-chlorophenyl)sulfanylpyridazine-3-carbonyl]amino]-4-methylpentanoic acid (PubChem CID 119357320) has the molecular formula C17H18ClN3O3S and a molecular weight of 379.87 g/mol. Its IUPAC name is 4-[[6-(2-chlorophenyl)sulfanylpyridazine-3-carbonyl]amino]-4-methylpentanoic acid.
| Compound Name | 4-[[6-(2-chlorophenyl)sulfanylpyridazine-3-carbonyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119357320 |
| Molecular Formula | C17H18ClN3O3S |
| Molecular Weight | 379.87 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 4-[[6-(2-chlorophenyl)sulfanylpyridazine-3-carbonyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)(CCC(=O)O)NC(=O)c1ccc(Sc2ccccc2Cl)nn1 |
| InChI | InChI=1S/C17H18ClN3O3S/c1-17(2,10-9-15(22)23)19-16(24)12-7-8-14(21-20-12)25-13-6-4-3-5-11(13)18/h3-8H,9-10H2,1-2H3,(H,19,24)(H,22,23) |
| InChIKey | WLYWNYGIOYXPEE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.87 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |