C16H17ClN4OS — CID 119513560
6-(2-chlorophenyl)sulfanyl-N-(pyrrolidin-2-ylmethyl)pyridazine-3-carboxamide (PubChem CID 119513560) has the molecular formula C16H17ClN4OS and a molecular weight of 348.86 g/mol. Its IUPAC name is 6-(2-chlorophenyl)sulfanyl-N-(pyrrolidin-2-ylmethyl)pyridazine-3-carboxamide.
| Compound Name | 6-(2-chlorophenyl)sulfanyl-N-(pyrrolidin-2-ylmethyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 119513560 |
| Molecular Formula | C16H17ClN4OS |
| Molecular Weight | 348.86 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 6-(2-chlorophenyl)sulfanyl-N-(pyrrolidin-2-ylmethyl)pyridazine-3-carboxamide |
| SMILES | O=C(NCC1CCCN1)c1ccc(Sc2ccccc2Cl)nn1 |
| InChI | InChI=1S/C16H17ClN4OS/c17-12-5-1-2-6-14(12)23-15-8-7-13(20-21-15)16(22)19-10-11-4-3-9-18-11/h1-2,5-8,11,18H,3-4,9-10H2,(H,19,22) |
| InChIKey | PTONQRSDQNHUFI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.86 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |