C15H18Cl2N4OS — CID 119498507
N-(3-aminobutyl)-6-(2-chlorophenyl)sulfanylpyridazine-3-carboxamide;hydrochloride (PubChem CID 119498507) has the molecular formula C15H18Cl2N4OS and a molecular weight of 373.31 g/mol. Its IUPAC name is N-(3-aminobutyl)-6-(2-chlorophenyl)sulfanylpyridazine-3-carboxamide;hydrochloride.
| Compound Name | N-(3-aminobutyl)-6-(2-chlorophenyl)sulfanylpyridazine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119498507 |
| Molecular Formula | C15H18Cl2N4OS |
| Molecular Weight | 373.31 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | N-(3-aminobutyl)-6-(2-chlorophenyl)sulfanylpyridazine-3-carboxamide;hydrochloride |
| SMILES | CC(N)CCNC(=O)c1ccc(Sc2ccccc2Cl)nn1.Cl |
| InChI | InChI=1S/C15H17ClN4OS.ClH/c1-10(17)8-9-18-15(21)12-6-7-14(20-19-12)22-13-5-3-2-4-11(13)16;/h2-7,10H,8-9,17H2,1H3,(H,18,21);1H |
| InChIKey | RNMXHGLTFQJSOA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |