C20H17ClN4O3S — CID 71871538
N-[2-(3-amino-3-oxopropoxy)phenyl]-6-(2-chlorophenyl)sulfanylpyridazine-3-carboxamide (PubChem CID 71871538) has the molecular formula C20H17ClN4O3S and a molecular weight of 428.90 g/mol. Its IUPAC name is N-[2-(3-amino-3-oxopropoxy)phenyl]-6-(2-chlorophenyl)sulfanylpyridazine-3-carboxamide.
| Compound Name | N-[2-(3-amino-3-oxopropoxy)phenyl]-6-(2-chlorophenyl)sulfanylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 71871538 |
| Molecular Formula | C20H17ClN4O3S |
| Molecular Weight | 428.90 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | N-[2-(3-amino-3-oxopropoxy)phenyl]-6-(2-chlorophenyl)sulfanylpyridazine-3-carboxamide |
| SMILES | NC(=O)CCOc1ccccc1NC(=O)c1ccc(Sc2ccccc2Cl)nn1 |
| InChI | InChI=1S/C20H17ClN4O3S/c21-13-5-1-4-8-17(13)29-19-10-9-15(24-25-19)20(27)23-14-6-2-3-7-16(14)28-12-11-18(22)26/h1-10H,11-12H2,(H2,22,26)(H,23,27) |
| InChIKey | MUDLAPSUFABBTE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.90 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |