C17H17ClN4O2S — CID 102562430
6-(2-chlorophenyl)sulfanyl-N-(1-methyl-2-oxopiperidin-4-yl)pyridazine-3-carboxamide (PubChem CID 102562430) has the molecular formula C17H17ClN4O2S and a molecular weight of 376.87 g/mol. Its IUPAC name is 6-(2-chlorophenyl)sulfanyl-N-(1-methyl-2-oxopiperidin-4-yl)pyridazine-3-carboxamide.
| Compound Name | 6-(2-chlorophenyl)sulfanyl-N-(1-methyl-2-oxopiperidin-4-yl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 102562430 |
| Molecular Formula | C17H17ClN4O2S |
| Molecular Weight | 376.87 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 6-(2-chlorophenyl)sulfanyl-N-(1-methyl-2-oxopiperidin-4-yl)pyridazine-3-carboxamide |
| SMILES | CN1CCC(NC(=O)c2ccc(Sc3ccccc3Cl)nn2)CC1=O |
| InChI | InChI=1S/C17H17ClN4O2S/c1-22-9-8-11(10-16(22)23)19-17(24)13-6-7-15(21-20-13)25-14-5-3-2-4-12(14)18/h2-7,11H,8-10H2,1H3,(H,19,24) |
| InChIKey | NIBIWYAVKIUPLW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.87 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |