C16H9ClF4N4O — CID 30886939
N-(3-chloro-2-fluorophenyl)-1-[2-(trifluoromethyl)phenyl]triazole-4-carboxamide (PubChem CID 30886939) has the molecular formula C16H9ClF4N4O and a molecular weight of 384.72 g/mol. Its IUPAC name is N-(3-chloro-2-fluorophenyl)-1-[2-(trifluoromethyl)phenyl]triazole-4-carboxamide.
| Compound Name | N-(3-chloro-2-fluorophenyl)-1-[2-(trifluoromethyl)phenyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 30886939 |
| Molecular Formula | C16H9ClF4N4O |
| Molecular Weight | 384.72 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | N-(3-chloro-2-fluorophenyl)-1-[2-(trifluoromethyl)phenyl]triazole-4-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1F)c1cn(-c2ccccc2C(F)(F)F)nn1 |
| InChI | InChI=1S/C16H9ClF4N4O/c17-10-5-3-6-11(14(10)18)22-15(26)12-8-25(24-23-12)13-7-2-1-4-9(13)16(19,20)21/h1-8H,(H,22,26) |
| InChIKey | JTGQVNQBMHLGTL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.72 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |