C18H13F4N5O2 — CID 39917454
N'-[2-(4-fluorophenyl)acetyl]-1-[2-(trifluoromethyl)phenyl]triazole-4-carbohydrazide (PubChem CID 39917454) has the molecular formula C18H13F4N5O2 and a molecular weight of 407.33 g/mol. Its IUPAC name is N'-[2-(4-fluorophenyl)acetyl]-1-[2-(trifluoromethyl)phenyl]triazole-4-carbohydrazide.
| Compound Name | N'-[2-(4-fluorophenyl)acetyl]-1-[2-(trifluoromethyl)phenyl]triazole-4-carbohydrazide |
|---|---|
| PubChem CID | 39917454 |
| Molecular Formula | C18H13F4N5O2 |
| Molecular Weight | 407.33 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | N'-[2-(4-fluorophenyl)acetyl]-1-[2-(trifluoromethyl)phenyl]triazole-4-carbohydrazide |
| SMILES | O=C(Cc1ccc(F)cc1)NNC(=O)c1cn(-c2ccccc2C(F)(F)F)nn1 |
| InChI | InChI=1S/C18H13F4N5O2/c19-12-7-5-11(6-8-12)9-16(28)24-25-17(29)14-10-27(26-23-14)15-4-2-1-3-13(15)18(20,21)22/h1-8,10H,9H2,(H,24,28)(H,25,29) |
| InChIKey | WCQANLXAANHQAZ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|