C19H15F3N4O3 — CID 30886971
methyl 4-[[[1-[2-(trifluoromethyl)phenyl]triazole-4-carbonyl]amino]methyl]benzoate (PubChem CID 30886971) has the molecular formula C19H15F3N4O3 and a molecular weight of 404.35 g/mol. Its IUPAC name is methyl 4-[[[1-[2-(trifluoromethyl)phenyl]triazole-4-carbonyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[[1-[2-(trifluoromethyl)phenyl]triazole-4-carbonyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 30886971 |
| Molecular Formula | C19H15F3N4O3 |
| Molecular Weight | 404.35 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | methyl 4-[[[1-[2-(trifluoromethyl)phenyl]triazole-4-carbonyl]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNC(=O)c2cn(-c3ccccc3C(F)(F)F)nn2)cc1 |
| InChI | InChI=1S/C19H15F3N4O3/c1-29-18(28)13-8-6-12(7-9-13)10-23-17(27)15-11-26(25-24-15)16-5-3-2-4-14(16)19(20,21)22/h2-9,11H,10H2,1H3,(H,23,27) |
| InChIKey | XWKRZEOLWYOGQZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |